ID | 1642 |
Name | Buprenorphine |
Pubchem ID | 11969480 |
KEGG ID | N/A |
Source | Derivative of thebaine |
Type | Unknown |
Function | Analgesic |
Drug Like Properties | No |
Molecular Weight | 504.10 |
Exact mass | 503.280237 |
Molecular formula | C29H42ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 62.2 |
H-Bond Donor | 3 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CC(C)(C)C(C)(C1CC23CCC1(C4C25CCN(C3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)O.Cl |
Isomeric SMILE | C[C@]([C@H]1C[C@@]23CCC1([C@H]4[C@@]25CCN([C@@H]3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)(C(C)(C)C)O.Cl |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1643 |
Name | Buprenorphine |
Pubchem ID | 11969480 |
KEGG ID | N/A |
Source | Derivative of thebaine |
Type | Unknown |
Function | mu agonist(Partial) |
Drug Like Properties | No |
Molecular Weight | 504.10 |
Exact mass | 503.280237 |
Molecular formula | C29H42ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 62.2 |
H-Bond Donor | 3 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CC(C)(C)C(C)(C1CC23CCC1(C4C25CCN(C3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)O.Cl |
Isomeric SMILE | C[C@]([C@H]1C[C@@]23CCC1([C@H]4[C@@]25CCN([C@@H]3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)(C(C)(C)C)O.Cl |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1644 |
Name | Buprenorphine |
Pubchem ID | 11969480 |
KEGG ID | N/A |
Source | Derivative of thebaine |
Type | Unknown |
Function | Kappa agonist(Partial) |
Drug Like Properties | No |
Molecular Weight | 504.10 |
Exact mass | 503.280237 |
Molecular formula | C29H42ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 62.2 |
H-Bond Donor | 3 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CC(C)(C)C(C)(C1CC23CCC1(C4C25CCN(C3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)O.Cl |
Isomeric SMILE | C[C@]([C@H]1C[C@@]23CCC1([C@H]4[C@@]25CCN([C@@H]3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)(C(C)(C)C)O.Cl |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1645 |
Name | Buprenorphine |
Pubchem ID | 11969480 |
KEGG ID | N/A |
Source | Derivative of thebaine |
Type | Unknown |
Function | Delta Antagonist |
Drug Like Properties | No |
Molecular Weight | 504.10 |
Exact mass | 503.280237 |
Molecular formula | C29H42ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 62.2 |
H-Bond Donor | 3 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CC(C)(C)C(C)(C1CC23CCC1(C4C25CCN(C3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)O.Cl |
Isomeric SMILE | C[C@]([C@H]1C[C@@]23CCC1([C@H]4[C@@]25CCN([C@@H]3CC6=C5C(=C(C=C6)O)O4)CC7CC7)OC)(C(C)(C)C)O.Cl |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |